About 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile
6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile (PubChem CID 82363770) has the molecular formula C6H3N3S2
and a molecular weight of 181.25 g/mol. Its IUPAC name is 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile.
Molecular Properties
| Compound Name | 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile |
| PubChem CID | 82363770 |
| Molecular Formula | C6H3N3S2 |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 180.98 |
| IUPAC Name | 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile |
| SMILES | N#Cc1c(S)nc2sccn12 |
| InChI | InChI=1S/C6H3N3S2/c7-3-4-5(10)8-6-9(4)1-2-11-6/h1-2,10H |
| InChIKey | SFEDEWWHWZPGIR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile?
The IUPAC name of 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile (CID 82363770) is 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile.
What is the SMILES notation for 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile?
The canonical SMILES for 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile is N#Cc1c(S)nc2sccn12.
What is the InChIKey of 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile?
The InChIKey is SFEDEWWHWZPGIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3S2/c7-3-4-5(10)8-6-9(4)1-2-11-6/h1-2,10H.
What are the key properties of 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile?
6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile has a molecular weight of 181.25 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile is sourced from PubChem (CID 82363770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).