C6H3N3S2 — CID 82363770
6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile (PubChem CID 82363770) has the molecular formula C6H3N3S2 and a molecular weight of 181.25 g/mol. Its IUPAC name is 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile.
| Compound Name | 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 82363770 |
| Molecular Formula | C6H3N3S2 |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 180.98 |
| IUPAC Name | 6-sulfanylimidazo[2,1-b][1,3]thiazole-5-carbonitrile |
| SMILES | N#Cc1c(S)nc2sccn12 |
| InChI | InChI=1S/C6H3N3S2/c7-3-4-5(10)8-6-9(4)1-2-11-6/h1-2,10H |
| InChIKey | SFEDEWWHWZPGIR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|