C10H7N5OS — CID 43475589
2-[cyanomethyl-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetonitrile (PubChem CID 43475589) has the molecular formula C10H7N5OS and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-[cyanomethyl-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetonitrile |
|---|---|
| PubChem CID | 43475589 |
| Molecular Formula | C10H7N5OS |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-[cyanomethyl-(5-formylimidazo[2,1-b][1,3]thiazol-6-yl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)c1nc2sccn2c1C=O |
| InChI | InChI=1S/C10H7N5OS/c11-1-3-14(4-2-12)9-8(7-16)15-5-6-17-10(15)13-9/h5-7H,3-4H2 |
| InChIKey | SKSIVWPXOKYASY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 85.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|