C12H17N3OS — CID 63983441
6-[methyl(2-methylbutan-2-yl)amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 63983441) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 6-[methyl(2-methylbutan-2-yl)amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-[methyl(2-methylbutan-2-yl)amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63983441 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 6-[methyl(2-methylbutan-2-yl)amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | CCC(C)(C)N(C)c1nc2sccn2c1C=O |
| InChI | InChI=1S/C12H17N3OS/c1-5-12(2,3)14(4)10-9(8-16)15-6-7-17-11(15)13-10/h6-8H,5H2,1-4H3 |
| InChIKey | SRTPISFRTRUZSF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|