C15H15N3OS — CID 16780524
6-[methyl-[(2-methylphenyl)methyl]amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 16780524) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 6-[methyl-[(2-methylphenyl)methyl]amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-[methyl-[(2-methylphenyl)methyl]amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 16780524 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 6-[methyl-[(2-methylphenyl)methyl]amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | Cc1ccccc1CN(C)c1nc2sccn2c1C=O |
| InChI | InChI=1S/C15H15N3OS/c1-11-5-3-4-6-12(11)9-17(2)14-13(10-19)18-7-8-20-15(18)16-14/h3-8,10H,9H2,1-2H3 |
| InChIKey | QIBOYMHDAUNJCZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|