C11H10N4OS2 — CID 55013505
6-[methyl(1,3-thiazol-4-ylmethyl)amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 55013505) has the molecular formula C11H10N4OS2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 6-[methyl(1,3-thiazol-4-ylmethyl)amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-[methyl(1,3-thiazol-4-ylmethyl)amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 55013505 |
| Molecular Formula | C11H10N4OS2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 6-[methyl(1,3-thiazol-4-ylmethyl)amino]imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | CN(Cc1cscn1)c1nc2sccn2c1C=O |
| InChI | InChI=1S/C11H10N4OS2/c1-14(4-8-6-17-7-12-8)10-9(5-16)15-2-3-18-11(15)13-10/h2-3,5-7H,4H2,1H3 |
| InChIKey | MQPIIZHBMLRUFV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|