C11H10ClN3O2S — CID 55184898
6-chloro-2-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridine-3-carboxylic acid (PubChem CID 55184898) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 6-chloro-2-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 55184898 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 6-chloro-2-[methyl(1,3-thiazol-4-ylmethyl)amino]pyridine-3-carboxylic acid |
| SMILES | CN(Cc1cscn1)c1nc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C11H10ClN3O2S/c1-15(4-7-5-18-6-13-7)10-8(11(16)17)2-3-9(12)14-10/h2-3,5-6H,4H2,1H3,(H,16,17) |
| InChIKey | CWMBLIPYYSOEOA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|