C11H10ClN3O2S — CID 63824843
6-chloro-2-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-3-carboxylic acid (PubChem CID 63824843) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 6-chloro-2-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63824843 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 6-chloro-2-[2-(1,3-thiazol-4-yl)ethylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)nc1NCCc1cscn1 |
| InChI | InChI=1S/C11H10ClN3O2S/c12-9-2-1-8(11(16)17)10(15-9)13-4-3-7-5-18-6-14-7/h1-2,5-6H,3-4H2,(H,13,15)(H,16,17) |
| InChIKey | FKEQKCVZNSCUEK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|