About 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid
3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid (PubChem CID 80516563) has the molecular formula C9H8N4O2S
and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid.
Analyze 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid?
The IUPAC name of 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid (CID 80516563) is 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid.
What is the SMILES notation for 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid?
The canonical SMILES for 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid is O=C(O)c1ccnnc1NCc1cscn1.
What is the InChIKey of 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid?
The InChIKey is BLQYAPWAUHIDBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O2S/c14-9(15)7-1-2-12-13-8(7)10-3-6-4-16-5-11-6/h1-2,4-5H,3H2,(H,10,13)(H,14,15).
What are the key properties of 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid?
3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid has a molecular weight of 236.26 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-4-ylmethylamino)pyridazine-4-carboxylic acid is sourced from PubChem (CID 80516563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).