C11H9BrN2O2S — CID 114895801
5-bromo-2-(1,3-thiazol-4-ylmethylamino)benzoic acid (PubChem CID 114895801) has the molecular formula C11H9BrN2O2S and a molecular weight of 313.18 g/mol. Its IUPAC name is 5-bromo-2-(1,3-thiazol-4-ylmethylamino)benzoic acid.
| Compound Name | 5-bromo-2-(1,3-thiazol-4-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 114895801 |
| Molecular Formula | C11H9BrN2O2S |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 5-bromo-2-(1,3-thiazol-4-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Br)ccc1NCc1cscn1 |
| InChI | InChI=1S/C11H9BrN2O2S/c12-7-1-2-10(9(3-7)11(15)16)13-4-8-5-17-6-14-8/h1-3,5-6,13H,4H2,(H,15,16) |
| InChIKey | ODQWQVYAGZIBOQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |