C11H10FN3O2S — CID 113394261
5-amino-2-fluoro-4-(1,3-thiazol-4-ylmethylamino)benzoic acid (PubChem CID 113394261) has the molecular formula C11H10FN3O2S and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-amino-2-fluoro-4-(1,3-thiazol-4-ylmethylamino)benzoic acid.
| Compound Name | 5-amino-2-fluoro-4-(1,3-thiazol-4-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 113394261 |
| Molecular Formula | C11H10FN3O2S |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-amino-2-fluoro-4-(1,3-thiazol-4-ylmethylamino)benzoic acid |
| SMILES | Nc1cc(C(=O)O)c(F)cc1NCc1cscn1 |
| InChI | InChI=1S/C11H10FN3O2S/c12-8-2-10(9(13)1-7(8)11(16)17)14-3-6-4-18-5-15-6/h1-2,4-5,14H,3,13H2,(H,16,17) |
| InChIKey | CELRKOQLHKUSAC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|