C11H12N4OS — CID 63829683
3-amino-4-(1,3-thiazol-4-ylmethylamino)benzamide (PubChem CID 63829683) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is 3-amino-4-(1,3-thiazol-4-ylmethylamino)benzamide.
| Compound Name | 3-amino-4-(1,3-thiazol-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 63829683 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-amino-4-(1,3-thiazol-4-ylmethylamino)benzamide |
| SMILES | NC(=O)c1ccc(NCc2cscn2)c(N)c1 |
| InChI | InChI=1S/C11H12N4OS/c12-9-3-7(11(13)16)1-2-10(9)14-4-8-5-17-6-15-8/h1-3,5-6,14H,4,12H2,(H2,13,16) |
| InChIKey | NGYGGRZVAYFAFH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|