C10H10ClN3S — CID 115468994
4-chloro-2-N-(1,3-thiazol-4-ylmethyl)benzene-1,2-diamine (PubChem CID 115468994) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 4-chloro-2-N-(1,3-thiazol-4-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-(1,3-thiazol-4-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115468994 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-chloro-2-N-(1,3-thiazol-4-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(Cl)cc1NCc1cscn1 |
| InChI | InChI=1S/C10H10ClN3S/c11-7-1-2-9(12)10(3-7)13-4-8-5-15-6-14-8/h1-3,5-6,13H,4,12H2 |
| InChIKey | MNIJKANDASIQQG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|