C10H9ClN2S — CID 59740767
3-chloro-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 59740767) has the molecular formula C10H9ClN2S and a molecular weight of 224.72 g/mol. Its IUPAC name is 3-chloro-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 3-chloro-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 59740767 |
| Molecular Formula | C10H9ClN2S |
| Molecular Weight | 224.72 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 3-chloro-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Clc1cccc(NCc2cscn2)c1 |
| InChI | InChI=1S/C10H9ClN2S/c11-8-2-1-3-9(4-8)12-5-10-6-14-7-13-10/h1-4,6-7,12H,5H2 |
| InChIKey | LDPXQPBBZOLEBV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.72 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |