C11H13N3O2S2 — CID 61171584
N-[3-(1,3-thiazol-4-ylmethylamino)phenyl]methanesulfonamide (PubChem CID 61171584) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-[3-(1,3-thiazol-4-ylmethylamino)phenyl]methanesulfonamide.
| Compound Name | N-[3-(1,3-thiazol-4-ylmethylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 61171584 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-[3-(1,3-thiazol-4-ylmethylamino)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(NCc2cscn2)c1 |
| InChI | InChI=1S/C11H13N3O2S2/c1-18(15,16)14-10-4-2-3-9(5-10)12-6-11-7-17-8-13-11/h2-5,7-8,12,14H,6H2,1H3 |
| InChIKey | QNMICFBSXOBOHD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |