C16H22N4S — CID 99834704
3-(4-ethylpiperazin-1-yl)-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 99834704) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 3-(4-ethylpiperazin-1-yl)-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 3-(4-ethylpiperazin-1-yl)-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 99834704 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-(4-ethylpiperazin-1-yl)-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | CCN1CCN(c2cccc(NCc3cscn3)c2)CC1 |
| InChI | InChI=1S/C16H22N4S/c1-2-19-6-8-20(9-7-19)16-5-3-4-14(10-16)17-11-15-12-21-13-18-15/h3-5,10,12-13,17H,2,6-9,11H2,1H3 |
| InChIKey | RLJNLIQTSWQLMK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |