C17H23ClN4S — CID 119125309
3-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1,3-thiazol-4-ylmethyl)propan-1-amine (PubChem CID 119125309) has the molecular formula C17H23ClN4S and a molecular weight of 350.92 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1,3-thiazol-4-ylmethyl)propan-1-amine.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 119125309 |
| Molecular Formula | C17H23ClN4S |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-N-(1,3-thiazol-4-ylmethyl)propan-1-amine |
| SMILES | Clc1cccc(N2CCN(CCCNCc3cscn3)CC2)c1 |
| InChI | InChI=1S/C17H23ClN4S/c18-15-3-1-4-17(11-15)22-9-7-21(8-10-22)6-2-5-19-12-16-13-23-14-20-16/h1,3-4,11,13-14,19H,2,5-10,12H2 |
| InChIKey | DLHJZNBSRMWHBJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|