C14H14ClN3OS — CID 63038242
[4-(3-chlorophenyl)piperazin-1-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 63038242) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 63038242 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H14ClN3OS/c15-11-2-1-3-12(8-11)17-4-6-18(7-5-17)14(19)13-9-20-10-16-13/h1-3,8-10H,4-7H2 |
| InChIKey | WYDKGTSJZXUKFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |