C19H22ClN5O — CID 109111774
[4-(3-chlorophenyl)piperazin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone (PubChem CID 109111774) has the molecular formula C19H22ClN5O and a molecular weight of 371.87 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone |
|---|---|
| PubChem CID | 109111774 |
| Molecular Formula | C19H22ClN5O |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-(6-pyrrolidin-1-ylpyridazin-3-yl)methanone |
| SMILES | O=C(c1ccc(N2CCCC2)nn1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H22ClN5O/c20-15-4-3-5-16(14-15)23-10-12-25(13-11-23)19(26)17-6-7-18(22-21-17)24-8-1-2-9-24/h3-7,14H,1-2,8-13H2 |
| InChIKey | PLHVWINQHVFDMB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |