C22H27ClN4O — CID 109174449
[2-(azepan-1-yl)-4-pyridinyl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 109174449) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is [2-(azepan-1-yl)-4-pyridinyl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(azepan-1-yl)-4-pyridinyl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 109174449 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | [2-(azepan-1-yl)-4-pyridinyl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccnc(N2CCCCCC2)c1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H27ClN4O/c23-19-6-5-7-20(17-19)25-12-14-27(15-13-25)22(28)18-8-9-24-21(16-18)26-10-3-1-2-4-11-26/h5-9,16-17H,1-4,10-15H2 |
| InChIKey | XDTAPQQUSKLYNA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |