C21H26ClN5O — CID 109124005
[6-[4-(3-chlorophenyl)piperazin-1-yl]pyridazin-3-yl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 109124005) has the molecular formula C21H26ClN5O and a molecular weight of 399.93 g/mol. Its IUPAC name is [6-[4-(3-chlorophenyl)piperazin-1-yl]pyridazin-3-yl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [6-[4-(3-chlorophenyl)piperazin-1-yl]pyridazin-3-yl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109124005 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [6-[4-(3-chlorophenyl)piperazin-1-yl]pyridazin-3-yl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2ccc(N3CCN(c4cccc(Cl)c4)CC3)nn2)C1 |
| InChI | InChI=1S/C21H26ClN5O/c1-16-4-3-9-27(15-16)21(28)19-7-8-20(24-23-19)26-12-10-25(11-13-26)18-6-2-5-17(22)14-18/h2,5-8,14,16H,3-4,9-13,15H2,1H3 |
| InChIKey | MGUGTZJTPNDUIK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |