C24H27ClN4O3 — CID 142679836
N-[[3-(1,3-benzodioxol-5-yl)-1,2-oxazol-5-yl]methyl]-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-amine (PubChem CID 142679836) has the molecular formula C24H27ClN4O3 and a molecular weight of 454.96 g/mol. Its IUPAC name is N-[[3-(1,3-benzodioxol-5-yl)-1,2-oxazol-5-yl]methyl]-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-amine.
| Compound Name | N-[[3-(1,3-benzodioxol-5-yl)-1,2-oxazol-5-yl]methyl]-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 142679836 |
| Molecular Formula | C24H27ClN4O3 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[[3-(1,3-benzodioxol-5-yl)-1,2-oxazol-5-yl]methyl]-3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-amine |
| SMILES | Clc1cccc(N2CCN(CCCNCc3cc(-c4ccc5c(c4)OCO5)no3)CC2)c1 |
| InChI | InChI=1S/C24H27ClN4O3/c25-19-3-1-4-20(14-19)29-11-9-28(10-12-29)8-2-7-26-16-21-15-22(27-32-21)18-5-6-23-24(13-18)31-17-30-23/h1,3-6,13-15,26H,2,7-12,16-17H2 |
| InChIKey | VWPSDHIVSUPZST-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|