C24H24ClF3N4O2 — CID 66575751
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]-1,2-oxazole-5-carboxamide (PubChem CID 66575751) has the molecular formula C24H24ClF3N4O2 and a molecular weight of 492.93 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 66575751 |
| Molecular Formula | C24H24ClF3N4O2 |
| Molecular Weight | 492.93 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[2-(trifluoromethyl)phenyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2cccc(Cl)c2)CC1)c1cc(-c2ccccc2C(F)(F)F)no1 |
| InChI | InChI=1S/C24H24ClF3N4O2/c25-17-5-3-6-18(15-17)32-13-11-31(12-14-32)10-4-9-29-23(33)22-16-21(30-34-22)19-7-1-2-8-20(19)24(26,27)28/h1-3,5-8,15-16H,4,9-14H2,(H,29,33) |
| InChIKey | DOYOKUQMDBOYDS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.93 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|