About 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone
4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone (PubChem CID 17096093) has the molecular formula C20H17ClFN3O2
and a molecular weight of 385.80 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanone.
Molecular Properties
| Compound Name | 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone |
| PubChem CID | 17096093 |
| Molecular Formula | C20H17ClFN3O2 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanone |
| SMILES | C1CN(CCN1C2=CC(=CC=C2)Cl)C(=O)C3=CC(=NO3)C4=CC=CC=C4F |
| InChI | InChI=1S/C20H17ClFN3O2/c21-14-4-3-5-15(12-14)24-8-10-25(11-9-24)20(26)19-13-18(23-27-19)16-6-1-2-7-17(16)22/h1-7,12-13H,8-11H2 |
| InChIKey | UXZVMTQUJPVNOU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | 517 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone?
The IUPAC name of 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone (CID 17096093) is [4-(3-chlorophenyl)piperazin-1-yl]-[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methanone.
What is the SMILES notation for 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone?
The canonical SMILES for 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone is C1CN(CCN1C2=CC(=CC=C2)Cl)C(=O)C3=CC(=NO3)C4=CC=CC=C4F.
What is the InChIKey of 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone?
The InChIKey is UXZVMTQUJPVNOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17ClFN3O2/c21-14-4-3-5-15(12-14)24-8-10-25(11-9-24)20(26)19-13-18(23-27-19)16-6-1-2-7-17(16)22/h1-7,12-13H,8-11H2.
What are the key properties of 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone?
4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone has a molecular weight of 385.80 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-Chlorophenyl)piperazinyl 3-(2-fluorophenyl)isoxazol-5-yl ketone is sourced from PubChem (CID 17096093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).