C17H22N4O2 — CID 119393897
3-phenyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-5-carboxamide (PubChem CID 119393897) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-phenyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-5-carboxamide.
| Compound Name | 3-phenyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 119393897 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-phenyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C17H22N4O2/c22-17(19-7-4-10-21-11-8-18-9-12-21)16-13-15(20-23-16)14-5-2-1-3-6-14/h1-3,5-6,13,18H,4,7-12H2,(H,19,22) |
| InChIKey | HFMTWUQCJXUMBN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|