C18H25ClN4O — CID 119392506
5-phenyl-N-(3-piperazin-1-ylpropyl)-1H-pyrrole-2-carboxamide;hydrochloride (PubChem CID 119392506) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is 5-phenyl-N-(3-piperazin-1-ylpropyl)-1H-pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 5-phenyl-N-(3-piperazin-1-ylpropyl)-1H-pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119392506 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 5-phenyl-N-(3-piperazin-1-ylpropyl)-1H-pyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCN1CCNCC1)c1ccc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C18H24N4O.ClH/c23-18(20-9-4-12-22-13-10-19-11-14-22)17-8-7-16(21-17)15-5-2-1-3-6-15;/h1-3,5-8,19,21H,4,9-14H2,(H,20,23);1H |
| InChIKey | WJHRNJMQHLJHTR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|