C16H25ClN4O2 — CID 119393183
N-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]benzamide;hydrochloride (PubChem CID 119393183) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.85 g/mol. Its IUPAC name is N-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]benzamide;hydrochloride.
| Compound Name | N-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119393183 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[2-oxo-2-(3-piperazin-1-ylpropylamino)ethyl]benzamide;hydrochloride |
| SMILES | Cl.O=C(CNC(=O)c1ccccc1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C16H24N4O2.ClH/c21-15(13-19-16(22)14-5-2-1-3-6-14)18-7-4-10-20-11-8-17-9-12-20;/h1-3,5-6,17H,4,7-13H2,(H,18,21)(H,19,22);1H |
| InChIKey | CRZOFFHAOGXFRY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|