C18H21N3O3 — CID 121262550
N-(3-oxo-3-piperidin-1-ylpropyl)-3-phenyl-1,2-oxazole-5-carboxamide (PubChem CID 121262550) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is N-(3-oxo-3-piperidin-1-ylpropyl)-3-phenyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(3-oxo-3-piperidin-1-ylpropyl)-3-phenyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 121262550 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-(3-oxo-3-piperidin-1-ylpropyl)-3-phenyl-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCCCC1)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C18H21N3O3/c22-17(21-11-5-2-6-12-21)9-10-19-18(23)16-13-15(20-24-16)14-7-3-1-4-8-14/h1,3-4,7-8,13H,2,5-6,9-12H2,(H,19,23) |
| InChIKey | CSYMBVWRSITALQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |