C18H22N2O2 — CID 174304762
1-(3-phenyl-1,2-oxazol-5-yl)-2-piperidin-1-ylbutan-1-one (PubChem CID 174304762) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(3-phenyl-1,2-oxazol-5-yl)-2-piperidin-1-ylbutan-1-one.
| Compound Name | 1-(3-phenyl-1,2-oxazol-5-yl)-2-piperidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 174304762 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-(3-phenyl-1,2-oxazol-5-yl)-2-piperidin-1-ylbutan-1-one |
| SMILES | CCC(C(=O)c1cc(-c2ccccc2)no1)N1CCCCC1 |
| InChI | InChI=1S/C18H22N2O2/c1-2-16(20-11-7-4-8-12-20)18(21)17-13-15(19-22-17)14-9-5-3-6-10-14/h3,5-6,9-10,13,16H,2,4,7-8,11-12H2,1H3 |
| InChIKey | XRJHLBBUAGRRPL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |