C17H22N2O2 — CID 139648109
(1S,2S)-1-(3-phenyl-1,2-oxazol-5-yl)-2-pyrrolidin-1-ylbutan-1-ol (PubChem CID 139648109) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (1S,2S)-1-(3-phenyl-1,2-oxazol-5-yl)-2-pyrrolidin-1-ylbutan-1-ol.
| Compound Name | (1S,2S)-1-(3-phenyl-1,2-oxazol-5-yl)-2-pyrrolidin-1-ylbutan-1-ol |
|---|---|
| PubChem CID | 139648109 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1S,2S)-1-(3-phenyl-1,2-oxazol-5-yl)-2-pyrrolidin-1-ylbutan-1-ol |
| SMILES | CC[C@@H]([C@H](O)c1cc(-c2ccccc2)no1)N1CCCC1 |
| InChI | InChI=1S/C17H22N2O2/c1-2-15(19-10-6-7-11-19)17(20)16-12-14(18-21-16)13-8-4-3-5-9-13/h3-5,8-9,12,15,17,20H,2,6-7,10-11H2,1H3/t15-,17-/m0/s1 |
| InChIKey | JMVXOEHMFDZBLN-RDJZCZTQSA-N |
| XLogP | 3.25 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |