C14H16N2O3 — CID 43428096
N-(1-hydroxybutan-2-yl)-3-phenyl-1,2-oxazole-5-carboxamide (PubChem CID 43428096) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-yl)-3-phenyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-(1-hydroxybutan-2-yl)-3-phenyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 43428096 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-(1-hydroxybutan-2-yl)-3-phenyl-1,2-oxazole-5-carboxamide |
| SMILES | CCC(CO)NC(=O)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C14H16N2O3/c1-2-11(9-17)15-14(18)13-8-12(16-19-13)10-6-4-3-5-7-10/h3-8,11,17H,2,9H2,1H3,(H,15,18) |
| InChIKey | HJWDKUKHABPDND-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |