C16H18N2O4 — CID 119188577
4-methyl-2-[(3-phenyl-1,2-oxazole-5-carbonyl)amino]pentanoic acid (PubChem CID 119188577) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-methyl-2-[(3-phenyl-1,2-oxazole-5-carbonyl)amino]pentanoic acid.
| Compound Name | 4-methyl-2-[(3-phenyl-1,2-oxazole-5-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 119188577 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-methyl-2-[(3-phenyl-1,2-oxazole-5-carbonyl)amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)c1cc(-c2ccccc2)no1)C(=O)O |
| InChI | InChI=1S/C16H18N2O4/c1-10(2)8-13(16(20)21)17-15(19)14-9-12(18-22-14)11-6-4-3-5-7-11/h3-7,9-10,13H,8H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | KMDPXHIIYRHEPW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |