C12H21ClN4O2 — CID 119394236
3-methyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-5-carboxamide;hydrochloride (PubChem CID 119394236) has the molecular formula C12H21ClN4O2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 3-methyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-5-carboxamide;hydrochloride.
| Compound Name | 3-methyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119394236 |
| Molecular Formula | C12H21ClN4O2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-methyl-N-(3-piperazin-1-ylpropyl)-1,2-oxazole-5-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NCCCN2CCNCC2)on1.Cl |
| InChI | InChI=1S/C12H20N4O2.ClH/c1-10-9-11(18-15-10)12(17)14-3-2-6-16-7-4-13-5-8-16;/h9,13H,2-8H2,1H3,(H,14,17);1H |
| InChIKey | YIHWJPGSJULIQP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|