C13H22ClN3O2S — CID 119392043
5-methylsulfanyl-N-(3-piperazin-1-ylpropyl)furan-2-carboxamide;hydrochloride (PubChem CID 119392043) has the molecular formula C13H22ClN3O2S and a molecular weight of 319.86 g/mol. Its IUPAC name is 5-methylsulfanyl-N-(3-piperazin-1-ylpropyl)furan-2-carboxamide;hydrochloride.
| Compound Name | 5-methylsulfanyl-N-(3-piperazin-1-ylpropyl)furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119392043 |
| Molecular Formula | C13H22ClN3O2S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-methylsulfanyl-N-(3-piperazin-1-ylpropyl)furan-2-carboxamide;hydrochloride |
| SMILES | CSc1ccc(C(=O)NCCCN2CCNCC2)o1.Cl |
| InChI | InChI=1S/C13H21N3O2S.ClH/c1-19-12-4-3-11(18-12)13(17)15-5-2-8-16-9-6-14-7-10-16;/h3-4,14H,2,5-10H2,1H3,(H,15,17);1H |
| InChIKey | SRWGWKZTPJZJRQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|