C9H14N2O2S — CID 119406286
N-(3-aminopropyl)-5-methylsulfanylfuran-2-carboxamide (PubChem CID 119406286) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-methylsulfanylfuran-2-carboxamide.
| Compound Name | N-(3-aminopropyl)-5-methylsulfanylfuran-2-carboxamide |
|---|---|
| PubChem CID | 119406286 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | N-(3-aminopropyl)-5-methylsulfanylfuran-2-carboxamide |
| SMILES | CSc1ccc(C(=O)NCCCN)o1 |
| InChI | InChI=1S/C9H14N2O2S/c1-14-8-4-3-7(13-8)9(12)11-6-2-5-10/h3-4H,2,5-6,10H2,1H3,(H,11,12) |
| InChIKey | VKVAHGCUKKCSBC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|