C10H17ClN2O2S — CID 120832608
N-[2-(methylamino)propyl]-5-methylsulfanylfuran-2-carboxamide;hydrochloride (PubChem CID 120832608) has the molecular formula C10H17ClN2O2S and a molecular weight of 264.78 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-5-methylsulfanylfuran-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(methylamino)propyl]-5-methylsulfanylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120832608 |
| Molecular Formula | C10H17ClN2O2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-[2-(methylamino)propyl]-5-methylsulfanylfuran-2-carboxamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1ccc(SC)o1.Cl |
| InChI | InChI=1S/C10H16N2O2S.ClH/c1-7(11-2)6-12-10(13)8-4-5-9(14-8)15-3;/h4-5,7,11H,6H2,1-3H3,(H,12,13);1H |
| InChIKey | XBXHPGDGYPTGOU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |