C12H20N2O3 — CID 82942250
5-(aminomethyl)-N-(3-propoxypropyl)furan-2-carboxamide (PubChem CID 82942250) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(3-propoxypropyl)furan-2-carboxamide.
| Compound Name | 5-(aminomethyl)-N-(3-propoxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82942250 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 5-(aminomethyl)-N-(3-propoxypropyl)furan-2-carboxamide |
| SMILES | CCCOCCCNC(=O)c1ccc(CN)o1 |
| InChI | InChI=1S/C12H20N2O3/c1-2-7-16-8-3-6-14-12(15)11-5-4-10(9-13)17-11/h4-5H,2-3,6-9,13H2,1H3,(H,14,15) |
| InChIKey | GMEXNDGFQZBXDN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|