C11H18N2O4 — CID 114100067
5-(aminomethyl)-N-(2,3-dimethoxypropyl)furan-2-carboxamide (PubChem CID 114100067) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,3-dimethoxypropyl)furan-2-carboxamide.
| Compound Name | 5-(aminomethyl)-N-(2,3-dimethoxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 114100067 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5-(aminomethyl)-N-(2,3-dimethoxypropyl)furan-2-carboxamide |
| SMILES | COCC(CNC(=O)c1ccc(CN)o1)OC |
| InChI | InChI=1S/C11H18N2O4/c1-15-7-9(16-2)6-13-11(14)10-4-3-8(5-12)17-10/h3-4,9H,5-7,12H2,1-2H3,(H,13,14) |
| InChIKey | HGLLOKSLDYUAEP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |