C11H15NO5S — CID 103958190
methyl 2-hydroxy-3-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]propanoate (PubChem CID 103958190) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 103958190 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | methyl 2-hydroxy-3-[[5-(methylsulfanylmethyl)furan-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1ccc(CSC)o1 |
| InChI | InChI=1S/C11H15NO5S/c1-16-11(15)8(13)5-12-10(14)9-4-3-7(17-9)6-18-2/h3-4,8,13H,5-6H2,1-2H3,(H,12,14) |
| InChIKey | MYRKSZWSGFMZPI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |