C8H11NO2S — CID 60637044
N-methyl-5-(methylsulfanylmethyl)furan-2-carboxamide (PubChem CID 60637044) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is N-methyl-5-(methylsulfanylmethyl)furan-2-carboxamide.
| Compound Name | N-methyl-5-(methylsulfanylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 60637044 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | N-methyl-5-(methylsulfanylmethyl)furan-2-carboxamide |
| SMILES | CNC(=O)c1ccc(CSC)o1 |
| InChI | InChI=1S/C8H11NO2S/c1-9-8(10)7-4-3-6(11-7)5-12-2/h3-4H,5H2,1-2H3,(H,9,10) |
| InChIKey | DWTDUWOJERPXLE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |