C12H19NO4S — CID 113435006
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-(methylsulfanylmethyl)furan-2-carboxamide (PubChem CID 113435006) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-(methylsulfanylmethyl)furan-2-carboxamide.
| Compound Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-(methylsulfanylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 113435006 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-5-(methylsulfanylmethyl)furan-2-carboxamide |
| SMILES | CCC(CO)(CO)NC(=O)c1ccc(CSC)o1 |
| InChI | InChI=1S/C12H19NO4S/c1-3-12(7-14,8-15)13-11(16)10-5-4-9(17-10)6-18-2/h4-5,14-15H,3,6-8H2,1-2H3,(H,13,16) |
| InChIKey | AWLYTLBYGUAXAM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |