C10H16N2O2 — CID 137320445
3-methyl-N-pentyl-1,2-oxazole-5-carboxamide (PubChem CID 137320445) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-methyl-N-pentyl-1,2-oxazole-5-carboxamide.
| Compound Name | 3-methyl-N-pentyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 137320445 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3-methyl-N-pentyl-1,2-oxazole-5-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(C)no1 |
| InChI | InChI=1S/C10H16N2O2/c1-3-4-5-6-11-10(13)9-7-8(2)12-14-9/h7H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | WZVJQLNOAJZVQO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|