C14H14N2O4 — CID 43665789
4-[2-[(3-methyl-1,2-oxazole-5-carbonyl)amino]ethyl]benzoic acid (PubChem CID 43665789) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-[2-[(3-methyl-1,2-oxazole-5-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[(3-methyl-1,2-oxazole-5-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 43665789 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-[2-[(3-methyl-1,2-oxazole-5-carbonyl)amino]ethyl]benzoic acid |
| SMILES | Cc1cc(C(=O)NCCc2ccc(C(=O)O)cc2)on1 |
| InChI | InChI=1S/C14H14N2O4/c1-9-8-12(20-16-9)13(17)15-7-6-10-2-4-11(5-3-10)14(18)19/h2-5,8H,6-7H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | BBZAENLEENESOT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |