C16H18N2O3 — CID 138042530
4-[2-[(2,5-dimethyl-1H-pyrrole-3-carbonyl)amino]ethyl]benzoic acid (PubChem CID 138042530) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-[2-[(2,5-dimethyl-1H-pyrrole-3-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2,5-dimethyl-1H-pyrrole-3-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 138042530 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-[2-[(2,5-dimethyl-1H-pyrrole-3-carbonyl)amino]ethyl]benzoic acid |
| SMILES | Cc1cc(C(=O)NCCc2ccc(C(=O)O)cc2)c(C)[nH]1 |
| InChI | InChI=1S/C16H18N2O3/c1-10-9-14(11(2)18-10)15(19)17-8-7-12-3-5-13(6-4-12)16(20)21/h3-6,9,18H,7-8H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | YTWMYEKFKOKDOW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |