4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid

C16H17NO4 — CID 119168767

IUPAC4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid
SMILESCc1cc(C)c(C(=O)NCCc2ccc(C(=O)O)cc2)o1
InChIInChI=1S/C16H17NO4/c1-10-9-11(2)21-14(10)15(18)17-8-7-12-3-5-13(6-4-12)16(19)20/h3-6,9H,7-8H2,1-2H3,(H,17,18)(H,19,20)
InChIKeyLARNBRFSGWLFJC-UHFFFAOYSA-N
MW287.32 g/mol
LogP2.57
Rot. Bonds5

About 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid

4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid (PubChem CID 119168767) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid.

Molecular Properties

Compound Name4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid
PubChem CID119168767
Molecular FormulaC16H17NO4
Molecular Weight287.32 g/mol
Exact Mass287.12
IUPAC Name4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid
SMILESCc1cc(C)c(C(=O)NCCc2ccc(C(=O)O)cc2)o1
InChIInChI=1S/C16H17NO4/c1-10-9-11(2)21-14(10)15(18)17-8-7-12-3-5-13(6-4-12)16(19)20/h3-6,9H,7-8H2,1-2H3,(H,17,18)(H,19,20)
InChIKeyLARNBRFSGWLFJC-UHFFFAOYSA-N
XLogP2.57
TPSA79.54 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.32
LogP ≤ 52.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid?
The IUPAC name of 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid (CID 119168767) is 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid.
What is the SMILES notation for 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid?
The canonical SMILES for 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid is Cc1cc(C)c(C(=O)NCCc2ccc(C(=O)O)cc2)o1.
What is the InChIKey of 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid?
The InChIKey is LARNBRFSGWLFJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4/c1-10-9-11(2)21-14(10)15(18)17-8-7-12-3-5-13(6-4-12)16(19)20/h3-6,9H,7-8H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid?
4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid has a molecular weight of 287.32 g/mol, XLogP of 2.57, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid is sourced from PubChem (CID 119168767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).