C16H17NO4 — CID 119168767
4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid (PubChem CID 119168767) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 119168767 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-[2-[(3,5-dimethylfuran-2-carbonyl)amino]ethyl]benzoic acid |
| SMILES | Cc1cc(C)c(C(=O)NCCc2ccc(C(=O)O)cc2)o1 |
| InChI | InChI=1S/C16H17NO4/c1-10-9-11(2)21-14(10)15(18)17-8-7-12-3-5-13(6-4-12)16(19)20/h3-6,9H,7-8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | LARNBRFSGWLFJC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |