C13H21NO3 — CID 111780822
N-(2-ethyl-2-hydroxybutyl)-3,5-dimethylfuran-2-carboxamide (PubChem CID 111780822) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is N-(2-ethyl-2-hydroxybutyl)-3,5-dimethylfuran-2-carboxamide.
| Compound Name | N-(2-ethyl-2-hydroxybutyl)-3,5-dimethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111780822 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-(2-ethyl-2-hydroxybutyl)-3,5-dimethylfuran-2-carboxamide |
| SMILES | CCC(O)(CC)CNC(=O)c1oc(C)cc1C |
| InChI | InChI=1S/C13H21NO3/c1-5-13(16,6-2)8-14-12(15)11-9(3)7-10(4)17-11/h7,16H,5-6,8H2,1-4H3,(H,14,15) |
| InChIKey | KNRTZCIOZDWFAC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |