C14H23NO3 — CID 111789808
N-(3-ethyl-2-hydroxypentyl)-3,5-dimethylfuran-2-carboxamide (PubChem CID 111789808) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-3,5-dimethylfuran-2-carboxamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-3,5-dimethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111789808 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-3,5-dimethylfuran-2-carboxamide |
| SMILES | CCC(CC)C(O)CNC(=O)c1oc(C)cc1C |
| InChI | InChI=1S/C14H23NO3/c1-5-11(6-2)12(16)8-15-14(17)13-9(3)7-10(4)18-13/h7,11-12,16H,5-6,8H2,1-4H3,(H,15,17) |
| InChIKey | DQMGPOOHHJJDGW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |