C16H25NO2 — CID 103770620
N-(3-ethyl-2-hydroxypentyl)-2,6-dimethylbenzamide (PubChem CID 103770620) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-2,6-dimethylbenzamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 103770620 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-2,6-dimethylbenzamide |
| SMILES | CCC(CC)C(O)CNC(=O)c1c(C)cccc1C |
| InChI | InChI=1S/C16H25NO2/c1-5-13(6-2)14(18)10-17-16(19)15-11(3)8-7-9-12(15)4/h7-9,13-14,18H,5-6,10H2,1-4H3,(H,17,19) |
| InChIKey | QHGPVMKWETZPAG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |