C15H23NO — CID 103714285
N-(2-ethylbutyl)-2,6-dimethylbenzamide (PubChem CID 103714285) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-(2-ethylbutyl)-2,6-dimethylbenzamide.
| Compound Name | N-(2-ethylbutyl)-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 103714285 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-(2-ethylbutyl)-2,6-dimethylbenzamide |
| SMILES | CCC(CC)CNC(=O)c1c(C)cccc1C |
| InChI | InChI=1S/C15H23NO/c1-5-13(6-2)10-16-15(17)14-11(3)8-7-9-12(14)4/h7-9,13H,5-6,10H2,1-4H3,(H,16,17) |
| InChIKey | WRZUDMODLYHDMM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |