C12H16N2O3 — CID 114152583
N-(3-amino-2-hydroxy-3-oxopropyl)-2,6-dimethylbenzamide (PubChem CID 114152583) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-2,6-dimethylbenzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2,6-dimethylbenzamide |
|---|---|
| PubChem CID | 114152583 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-2,6-dimethylbenzamide |
| SMILES | Cc1cccc(C)c1C(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C12H16N2O3/c1-7-4-3-5-8(2)10(7)12(17)14-6-9(15)11(13)16/h3-5,9,15H,6H2,1-2H3,(H2,13,16)(H,14,17) |
| InChIKey | IQAVSFKOTFIAOC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |