C9H10FN3O3 — CID 106166087
N-(3-amino-2-hydroxy-3-oxopropyl)-6-fluoropyridine-2-carboxamide (PubChem CID 106166087) has the molecular formula C9H10FN3O3 and a molecular weight of 227.20 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-6-fluoropyridine-2-carboxamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 106166087 |
| Molecular Formula | C9H10FN3O3 |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-6-fluoropyridine-2-carboxamide |
| SMILES | NC(=O)C(O)CNC(=O)c1cccc(F)n1 |
| InChI | InChI=1S/C9H10FN3O3/c10-7-3-1-2-5(13-7)9(16)12-4-6(14)8(11)15/h1-3,6,14H,4H2,(H2,11,15)(H,12,16) |
| InChIKey | CJYAZYRRDFDVQI-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|